About 2-methylfuran;(4-methylphenyl)boronic acid
2-methylfuran;(4-methylphenyl)boronic acid (PubChem CID 159728108) has the molecular formula C12H15BO3
and a molecular weight of 218.06 g/mol. Its IUPAC name is 2-methylfuran;(4-methylphenyl)boronic acid.
Molecular Properties
| Compound Name | 2-methylfuran;(4-methylphenyl)boronic acid |
| PubChem CID | 159728108 |
| Molecular Formula | C12H15BO3 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-methylfuran;(4-methylphenyl)boronic acid |
| SMILES | Cc1ccc(B(O)O)cc1.Cc1ccco1 |
| InChI | InChI=1S/C7H9BO2.C5H6O/c1-6-2-4-7(5-3-6)8(9)10;1-5-3-2-4-6-5/h2-5,9-10H,1H3;2-4H,1H3 |
| InChIKey | NAWRHKREWJXZQY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylfuran;(4-methylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylfuran;(4-methylphenyl)boronic acid?
The IUPAC name of 2-methylfuran;(4-methylphenyl)boronic acid (CID 159728108) is 2-methylfuran;(4-methylphenyl)boronic acid.
What is the SMILES notation for 2-methylfuran;(4-methylphenyl)boronic acid?
The canonical SMILES for 2-methylfuran;(4-methylphenyl)boronic acid is Cc1ccc(B(O)O)cc1.Cc1ccco1.
What is the InChIKey of 2-methylfuran;(4-methylphenyl)boronic acid?
The InChIKey is NAWRHKREWJXZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BO2.C5H6O/c1-6-2-4-7(5-3-6)8(9)10;1-5-3-2-4-6-5/h2-5,9-10H,1H3;2-4H,1H3.
What are the key properties of 2-methylfuran;(4-methylphenyl)boronic acid?
2-methylfuran;(4-methylphenyl)boronic acid has a molecular weight of 218.06 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylfuran;(4-methylphenyl)boronic acid is sourced from PubChem (CID 159728108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).