About 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate
2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate (PubChem CID 159728832) has the molecular formula C14H29NO4
and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate |
| PubChem CID | 159728832 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCN.CCCCOC(=O)C(C)C |
| InChI | InChI=1S/C8H16O2.C6H13NO2/c1-4-5-6-10-8(9)7(2)3;1-5(2)6(8)9-4-3-7/h7H,4-6H2,1-3H3;5H,3-4,7H2,1-2H3 |
| InChIKey | NAZBWZNYVJSZSU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate?
The IUPAC name of 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate (CID 159728832) is 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate.
What is the SMILES notation for 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate?
The canonical SMILES for 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate is CC(C)C(=O)OCCN.CCCCOC(=O)C(C)C.
What is the InChIKey of 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate?
The InChIKey is NAZBWZNYVJSZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H13NO2/c1-4-5-6-10-8(9)7(2)3;1-5(2)6(8)9-4-3-7/h7H,4-6H2,1-3H3;5H,3-4,7H2,1-2H3.
What are the key properties of 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate?
2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate has a molecular weight of 275.39 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-methylpropanoate;butyl 2-methylpropanoate is sourced from PubChem (CID 159728832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).