C14H33NO2 — CID 159729828
methane;3-methylbutan-2-one;2-methyl-N-propylpropanamide (PubChem CID 159729828) has the molecular formula C14H33NO2 and a molecular weight of 247.42 g/mol. Its IUPAC name is methane;3-methylbutan-2-one;2-methyl-N-propylpropanamide.
| Compound Name | methane;3-methylbutan-2-one;2-methyl-N-propylpropanamide |
|---|---|
| PubChem CID | 159729828 |
| Molecular Formula | C14H33NO2 |
| Molecular Weight | 247.42 g/mol |
| Exact Mass | 247.25 |
| IUPAC Name | methane;3-methylbutan-2-one;2-methyl-N-propylpropanamide |
| SMILES | C.C.CC(=O)C(C)C.CCCNC(=O)C(C)C |
| InChI | InChI=1S/C7H15NO.C5H10O.2CH4/c1-4-5-8-7(9)6(2)3;1-4(2)5(3)6;;/h6H,4-5H2,1-3H3,(H,8,9);4H,1-3H3;2*1H4 |
| InChIKey | NBCFKYMDIYAIJO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |