C22H24F3N5O — CID 159730168
2-[[4-[2-(111C)methoxy-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 159730168) has the molecular formula C22H24F3N5O and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[[4-[2-(111C)methoxy-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 2-[[4-[2-(111C)methoxy-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 159730168 |
| Molecular Formula | C22H24F3N5O |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[[4-[2-(111C)methoxy-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | [11CH3]Oc1cc(C(F)(F)F)ccc1N1CCN(Cc2nc3nccc4c3n2CCC4)CC1 |
| InChI | InChI=1S/C22H24F3N5O/c1-31-18-13-16(22(23,24)25)4-5-17(18)29-11-9-28(10-12-29)14-19-27-21-20-15(6-7-26-21)3-2-8-30(19)20/h4-7,13H,2-3,8-12,14H2,1H3/i1-1 |
| InChIKey | UDDMGASPEUVWRZ-BJUDXGSMSA-N |
| XLogP | 3.73 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |