C15H24O — CID 15973061
[(1S,2R,6R,7R)-2,6-dimethyl-8-methylidene-2-tricyclo[5.2.2.01,6]undecanyl]methanol (PubChem CID 15973061) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [(1S,2R,6R,7R)-2,6-dimethyl-8-methylidene-2-tricyclo[5.2.2.01,6]undecanyl]methanol.
| Compound Name | [(1S,2R,6R,7R)-2,6-dimethyl-8-methylidene-2-tricyclo[5.2.2.01,6]undecanyl]methanol |
|---|---|
| PubChem CID | 15973061 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(1S,2R,6R,7R)-2,6-dimethyl-8-methylidene-2-tricyclo[5.2.2.01,6]undecanyl]methanol |
| SMILES | C=C1C[C@@]23CC[C@H]1[C@@]2(C)CCC[C@@]3(C)CO |
| InChI | InChI=1S/C15H24O/c1-11-9-15-8-5-12(11)14(15,3)7-4-6-13(15,2)10-16/h12,16H,1,4-10H2,2-3H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | NHYQMLCUEBFCEJ-LXTVHRRPSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|