C17H23N3O8 — CID 159731305
(2S)-2-[(3R)-3-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2,6-dioxohexyl]pentanedioic acid (PubChem CID 159731305) has the molecular formula C17H23N3O8 and a molecular weight of 397.38 g/mol. Its IUPAC name is (2S)-2-[(3R)-3-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2,6-dioxohexyl]pentanedioic acid.
| Compound Name | (2S)-2-[(3R)-3-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2,6-dioxohexyl]pentanedioic acid |
|---|---|
| PubChem CID | 159731305 |
| Molecular Formula | C17H23N3O8 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S)-2-[(3R)-3-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2,6-dioxohexyl]pentanedioic acid |
| SMILES | N[C@H](CCC(=O)NCCN1C(=O)C=CC1=O)C(=O)CC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H23N3O8/c18-11(12(21)9-10(17(27)28)1-6-16(25)26)2-3-13(22)19-7-8-20-14(23)4-5-15(20)24/h4-5,10-11H,1-3,6-9,18H2,(H,19,22)(H,25,26)(H,27,28)/t10?,11-/m1/s1 |
| InChIKey | NBGOLOAOXAOMKQ-RRKGBCIJSA-N |
| XLogP | -1.34 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|