C32H29BrO6S2 — CID 159731943
8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;butane-1-thiol;8-butylsulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 159731943) has the molecular formula C32H29BrO6S2 and a molecular weight of 653.62 g/mol. Its IUPAC name is 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;butane-1-thiol;8-butylsulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;butane-1-thiol;8-butylsulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 159731943 |
| Molecular Formula | C32H29BrO6S2 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 652.06 |
| IUPAC Name | 8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;butane-1-thiol;8-butylsulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | CCCCS.CCCCSc1ccc2c3c(cccc13)C(=O)OC2=O.O=C1OC(=O)c2ccc(Br)c3cccc1c23 |
| InChI | InChI=1S/C16H14O3S.C12H5BrO3.C4H10S/c1-2-3-9-20-13-8-7-12-14-10(13)5-4-6-11(14)15(17)19-16(12)18;13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15;1-2-3-4-5/h4-8H,2-3,9H2,1H3;1-5H;5H,2-4H2,1H3 |
| InChIKey | NBINBBIHWRWEOJ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|