C38H32N4OZn — CID 15973323
zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-23-id-2-olate (PubChem CID 15973323) has the molecular formula C38H32N4OZn and a molecular weight of 626.09 g/mol. Its IUPAC name is zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-23-id-2-olate.
| Compound Name | zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-23-id-2-olate |
|---|---|
| PubChem CID | 15973323 |
| Molecular Formula | C38H32N4OZn |
| Molecular Weight | 626.09 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)porphyrin-23-id-2-olate |
| SMILES | Cc1ccc(/C2=c3\cc/c([n-]3)=C(\c3c(C)cc(C)cc3C)C3=N/C(=C\C4=C([O-])C(C)(C)C(=N4)/C=C4/C=CC2=N4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C38H33N4O.Zn/c1-21-7-9-25(10-8-21)35-28-13-12-27(40-28)20-33-38(5,6)37(43)32(42-33)19-26-11-14-30(39-26)36(31-16-15-29(35)41-31)34-23(3)17-22(2)18-24(34)4;/h7-20H,1-6H3,(H-,39,40,41,42,43);/q-1;+2/p-1 |
| InChIKey | ZOZRODKNJBEFBY-UHFFFAOYSA-M |
| XLogP | 5.13 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.09 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|