About methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate
methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate (PubChem CID 159733705) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate |
| PubChem CID | 159733705 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)CCc1ccc(/C=C/C(N)=O)nc1 |
| InChI | InChI=1S/C15H20N2O3/c1-15(2,14(19)20-3)9-8-11-4-5-12(17-10-11)6-7-13(16)18/h4-7,10H,8-9H2,1-3H3,(H2,16,18)/b7-6+ |
| InChIKey | ZRCVYDZSQFYLBY-VOTSOKGWSA-N |
| XLogP | 1.71 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate?
The IUPAC name of methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate (CID 159733705) is methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate.
What is the SMILES notation for methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate?
The canonical SMILES for methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate is COC(=O)C(C)(C)CCc1ccc(/C=C/C(N)=O)nc1.
What is the InChIKey of methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate?
The InChIKey is ZRCVYDZSQFYLBY-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-15(2,14(19)20-3)9-8-11-4-5-12(17-10-11)6-7-13(16)18/h4-7,10H,8-9H2,1-3H3,(H2,16,18)/b7-6+.
What are the key properties of methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate?
methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate has a molecular weight of 276.34 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[6-[(E)-3-amino-3-oxoprop-1-enyl]-3-pyridinyl]-2,2-dimethylbutanoate is sourced from PubChem (CID 159733705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).