C27H51N3 — CID 159733822
3,8-dimethyl-8-azabicyclo[3.2.1]octane;1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;3-methyl-1-azabicyclo[2.2.2]octane (PubChem CID 159733822) has the molecular formula C27H51N3 and a molecular weight of 417.73 g/mol. Its IUPAC name is 3,8-dimethyl-8-azabicyclo[3.2.1]octane;1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;3-methyl-1-azabicyclo[2.2.2]octane.
| Compound Name | 3,8-dimethyl-8-azabicyclo[3.2.1]octane;1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;3-methyl-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 159733822 |
| Molecular Formula | C27H51N3 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 417.41 |
| IUPAC Name | 3,8-dimethyl-8-azabicyclo[3.2.1]octane;1-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;3-methyl-1-azabicyclo[2.2.2]octane |
| SMILES | CC1CC2CCC(C1)N2C.CC1CCCN2CCCCC12.CC1CN2CCC1CC2 |
| InChI | InChI=1S/C10H19N.C9H17N.C8H15N/c1-9-5-4-8-11-7-3-2-6-10(9)11;1-7-5-8-3-4-9(6-7)10(8)2;1-7-6-9-4-2-8(7)3-5-9/h9-10H,2-8H2,1H3;7-9H,3-6H2,1-2H3;7-8H,2-6H2,1H3 |
| InChIKey | NBOQIMTYGIELFY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |