C40H50N2O6 — CID 159735071
ethyl 6-ethyl-8,9-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate;ethyl 6-ethyl-9,10-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 159735071) has the molecular formula C40H50N2O6 and a molecular weight of 654.85 g/mol. Its IUPAC name is ethyl 6-ethyl-8,9-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate;ethyl 6-ethyl-9,10-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 6-ethyl-8,9-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate;ethyl 6-ethyl-9,10-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 159735071 |
| Molecular Formula | C40H50N2O6 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | ethyl 6-ethyl-8,9-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate;ethyl 6-ethyl-9,10-dimethyl-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(CC)Cc3c(ccc(C)c3C)C2CC1=O.CCOC(=O)C1=CN2C(CC)Cc3cc(C)c(C)cc3C2CC1=O |
| InChI | InChI=1S/2C20H25NO3/c1-5-15-9-14-7-12(3)13(4)8-16(14)18-10-19(22)17(11-21(15)18)20(23)24-6-2;1-5-14-9-16-13(4)12(3)7-8-15(16)18-10-19(22)17(11-21(14)18)20(23)24-6-2/h7-8,11,15,18H,5-6,9-10H2,1-4H3;7-8,11,14,18H,5-6,9-10H2,1-4H3 |
| InChIKey | NBSPRCXWSRRJKW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|