About 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide
1,2-dichloroprop-1-ene;pyridin-1-ium;iodide (PubChem CID 159738262) has the molecular formula C8H10Cl2IN
and a molecular weight of 317.99 g/mol. Its IUPAC name is 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide.
Molecular Properties
| Compound Name | 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide |
| PubChem CID | 159738262 |
| Molecular Formula | C8H10Cl2IN |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide |
| SMILES | CC(Cl)=CCl.[I-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C5H5N.C3H4Cl2.HI/c1-2-4-6-5-3-1;1-3(5)2-4;/h1-5H;2H,1H3;1H |
| InChIKey | NCCOQFSIHNNRIB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide?
The IUPAC name of 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide (CID 159738262) is 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide.
What is the SMILES notation for 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide?
The canonical SMILES for 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide is CC(Cl)=CCl.[I-].c1cc[nH+]cc1.
What is the InChIKey of 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide?
The InChIKey is NCCOQFSIHNNRIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C3H4Cl2.HI/c1-2-4-6-5-3-1;1-3(5)2-4;/h1-5H;2H,1H3;1H.
What are the key properties of 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide?
1,2-dichloroprop-1-ene;pyridin-1-ium;iodide has a molecular weight of 317.99 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroprop-1-ene;pyridin-1-ium;iodide is sourced from PubChem (CID 159738262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).