About tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate
tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate (PubChem CID 159738613) has the molecular formula C24H40O7
and a molecular weight of 440.58 g/mol. Its IUPAC name is tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate.
Molecular Properties
| Compound Name | tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate |
| PubChem CID | 159738613 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)C1(C)OCCO1.C=CCC(C(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22O4.C11H18O3/c1-6-7-10(11(14)17-12(2,3)4)13(5)15-8-9-16-13;1-6-7-9(8(2)12)10(13)14-11(3,4)5/h6,10H,1,7-9H2,2-5H3;6,9H,1,7H2,2-5H3 |
| InChIKey | NCDQNHOWVLIOIF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate?
The IUPAC name of tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate (CID 159738613) is tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate.
What is the SMILES notation for tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate?
The canonical SMILES for tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate is C=CCC(C(=O)OC(C)(C)C)C1(C)OCCO1.C=CCC(C(C)=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate?
The InChIKey is NCDQNHOWVLIOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4.C11H18O3/c1-6-7-10(11(14)17-12(2,3)4)13(5)15-8-9-16-13;1-6-7-9(8(2)12)10(13)14-11(3,4)5/h6,10H,1,7-9H2,2-5H3;6,9H,1,7H2,2-5H3.
What are the key properties of tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate?
tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate has a molecular weight of 440.58 g/mol, XLogP of 4.39, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-acetylpent-4-enoate;tert-butyl 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoate is sourced from PubChem (CID 159738613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).