About thiourea;1,1,3-trimethylthiourea
thiourea;1,1,3-trimethylthiourea (PubChem CID 159738783) has the molecular formula C5H14N4S2
and a molecular weight of 194.33 g/mol. Its IUPAC name is thiourea;1,1,3-trimethylthiourea.
Molecular Properties
| Compound Name | thiourea;1,1,3-trimethylthiourea |
| PubChem CID | 159738783 |
| Molecular Formula | C5H14N4S2 |
| Molecular Weight | 194.33 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | thiourea;1,1,3-trimethylthiourea |
| SMILES | CNC(=S)N(C)C.NC(N)=S |
| InChI | InChI=1S/C4H10N2S.CH4N2S/c1-5-4(7)6(2)3;2-1(3)4/h1-3H3,(H,5,7);(H4,2,3,4) |
| InChIKey | NCEHBWXMBDJUHB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze thiourea;1,1,3-trimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiourea;1,1,3-trimethylthiourea?
The IUPAC name of thiourea;1,1,3-trimethylthiourea (CID 159738783) is thiourea;1,1,3-trimethylthiourea.
What is the SMILES notation for thiourea;1,1,3-trimethylthiourea?
The canonical SMILES for thiourea;1,1,3-trimethylthiourea is CNC(=S)N(C)C.NC(N)=S.
What is the InChIKey of thiourea;1,1,3-trimethylthiourea?
The InChIKey is NCEHBWXMBDJUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2S.CH4N2S/c1-5-4(7)6(2)3;2-1(3)4/h1-3H3,(H,5,7);(H4,2,3,4).
What are the key properties of thiourea;1,1,3-trimethylthiourea?
thiourea;1,1,3-trimethylthiourea has a molecular weight of 194.33 g/mol, XLogP of -0.76, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiourea;1,1,3-trimethylthiourea is sourced from PubChem (CID 159738783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).