About 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane
2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane (PubChem CID 159739585) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane |
| PubChem CID | 159739585 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane |
| SMILES | C.CC(C)C1Nc2ccccc2C1C(C)C |
| InChI | InChI=1S/C14H21N.CH4/c1-9(2)13-11-7-5-6-8-12(11)15-14(13)10(3)4;/h5-10,13-15H,1-4H3;1H4 |
| InChIKey | NCGWHYGFAODHLH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane?
The IUPAC name of 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane (CID 159739585) is 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane.
What is the SMILES notation for 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane?
The canonical SMILES for 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane is C.CC(C)C1Nc2ccccc2C1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane?
The InChIKey is NCGWHYGFAODHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N.CH4/c1-9(2)13-11-7-5-6-8-12(11)15-14(13)10(3)4;/h5-10,13-15H,1-4H3;1H4.
What are the key properties of 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane?
2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane has a molecular weight of 219.37 g/mol, XLogP of 4.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-2,3-dihydro-1H-indole;methane is sourced from PubChem (CID 159739585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).