About 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one
2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one (PubChem CID 159739741) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one.
Molecular Properties
| Compound Name | 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one |
| PubChem CID | 159739741 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one |
| SMILES | CC1C=CC(=O)C(C)O1.CC1CCC(=O)C(C)O1 |
| InChI | InChI=1S/C7H12O2.C7H10O2/c2*1-5-3-4-7(8)6(2)9-5/h5-6H,3-4H2,1-2H3;3-6H,1-2H3 |
| InChIKey | NCHLGXUORAUYSA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one?
The IUPAC name of 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one (CID 159739741) is 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one.
What is the SMILES notation for 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one?
The canonical SMILES for 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one is CC1C=CC(=O)C(C)O1.CC1CCC(=O)C(C)O1.
What is the InChIKey of 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one?
The InChIKey is NCHLGXUORAUYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C7H10O2/c2*1-5-3-4-7(8)6(2)9-5/h5-6H,3-4H2,1-2H3;3-6H,1-2H3.
What are the key properties of 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one?
2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one has a molecular weight of 254.33 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyloxan-3-one;2,6-dimethyl-2H-pyran-5-one is sourced from PubChem (CID 159739741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).