About 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid
4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid (PubChem CID 159742049) has the molecular formula C19H19ClN2O5S
and a molecular weight of 422.89 g/mol. Its IUPAC name is 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid.
Molecular Properties
| Compound Name | 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid |
| PubChem CID | 159742049 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid |
| SMILES | N#Cc1ccc(S[C@H](C[C@H](N)CO)c2ccccc2)c(Cl)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H17ClN2OS.C2H2O4/c18-15-8-12(10-19)6-7-16(15)22-17(9-14(20)11-21)13-4-2-1-3-5-13;3-1(4)2(5)6/h1-8,14,17,21H,9,11,20H2;(H,3,4)(H,5,6)/t14-,17+;/m0./s1 |
| InChIKey | NCORPPOAJKEBNJ-SQQLFYIASA-N |
| XLogP | 2.91 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid?
The IUPAC name of 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid (CID 159742049) is 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid.
What is the SMILES notation for 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid?
The canonical SMILES for 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid is N#Cc1ccc(S[C@H](C[C@H](N)CO)c2ccccc2)c(Cl)c1.O=C(O)C(=O)O.
What is the InChIKey of 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid?
The InChIKey is NCORPPOAJKEBNJ-SQQLFYIASA-N. The full InChI is InChI=1S/C17H17ClN2OS.C2H2O4/c18-15-8-12(10-19)6-7-16(15)22-17(9-14(20)11-21)13-4-2-1-3-5-13;3-1(4)2(5)6/h1-8,14,17,21H,9,11,20H2;(H,3,4)(H,5,6)/t14-,17+;/m0./s1.
What are the key properties of 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid?
4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid has a molecular weight of 422.89 g/mol, XLogP of 2.91, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,3S)-3-amino-4-hydroxy-1-phenylbutyl]sulfanyl-3-chlorobenzonitrile;oxalic acid is sourced from PubChem (CID 159742049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).