C14H18O2 — CID 159742479
1,2-dimethylcyclohexa-2,4-dien-1-ol;phenol (PubChem CID 159742479) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1,2-dimethylcyclohexa-2,4-dien-1-ol;phenol.
| Compound Name | 1,2-dimethylcyclohexa-2,4-dien-1-ol;phenol |
|---|---|
| PubChem CID | 159742479 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1,2-dimethylcyclohexa-2,4-dien-1-ol;phenol |
| SMILES | CC1=CC=CCC1(C)O.Oc1ccccc1 |
| InChI | InChI=1S/C8H12O.C6H6O/c1-7-5-3-4-6-8(7,2)9;7-6-4-2-1-3-5-6/h3-5,9H,6H2,1-2H3;1-5,7H |
| InChIKey | NCQCMXDPZVRCPR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |