About N,3-dimethylbut-3-enamide
N,3-dimethylbut-3-enamide (PubChem CID 159742921) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N,3-dimethylbut-3-enamide.
Molecular Properties
| Compound Name | N,3-dimethylbut-3-enamide |
| PubChem CID | 159742921 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N,3-dimethylbut-3-enamide |
| SMILES | C=C(C)CC(=O)NC.C=C(C)CC(=O)NC |
| InChI | InChI=1S/2C6H11NO/c2*1-5(2)4-6(8)7-3/h2*1,4H2,2-3H3,(H,7,8) |
| InChIKey | NCRKDSDKACLKKB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbut-3-enamide?
The IUPAC name of N,3-dimethylbut-3-enamide (CID 159742921) is N,3-dimethylbut-3-enamide.
What is the SMILES notation for N,3-dimethylbut-3-enamide?
The canonical SMILES for N,3-dimethylbut-3-enamide is C=C(C)CC(=O)NC.C=C(C)CC(=O)NC.
What is the InChIKey of N,3-dimethylbut-3-enamide?
The InChIKey is NCRKDSDKACLKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO/c2*1-5(2)4-6(8)7-3/h2*1,4H2,2-3H3,(H,7,8).
What are the key properties of N,3-dimethylbut-3-enamide?
N,3-dimethylbut-3-enamide has a molecular weight of 226.32 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbut-3-enamide is sourced from PubChem (CID 159742921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).