C14H13ClF6O4S — CID 159744159
1-tert-butylsulfonyl-4-chlorobenzene;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159744159) has the molecular formula C14H13ClF6O4S and a molecular weight of 426.76 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-4-chlorobenzene;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 1-tert-butylsulfonyl-4-chlorobenzene;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159744159 |
| Molecular Formula | C14H13ClF6O4S |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 1-tert-butylsulfonyl-4-chlorobenzene;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc(Cl)cc1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13ClO2S.C4F6O2/c1-10(2,3)14(12,13)9-6-4-8(11)5-7-9;5-3(6,7)1(11)2(12)4(8,9)10/h4-7H,1-3H3; |
| InChIKey | NCVHANSGNYVKTR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|