About 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione
1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione (PubChem CID 15974483) has the molecular formula C18H28O5
and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione |
| PubChem CID | 15974483 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione |
| SMILES | O=C1CCCCCCCCCCC=C2CC(CO)(CO1)OC2=O |
| InChI | InChI=1S/C18H28O5/c19-13-18-12-15(17(21)23-18)10-8-6-4-2-1-3-5-7-9-11-16(20)22-14-18/h10,19H,1-9,11-14H2 |
| InChIKey | HUACBKIRQBGPDW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione?
The IUPAC name of 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione (CID 15974483) is 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione.
What is the SMILES notation for 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione?
The canonical SMILES for 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione is O=C1CCCCCCCCCCC=C2CC(CO)(CO1)OC2=O.
What is the InChIKey of 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione?
The InChIKey is HUACBKIRQBGPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O5/c19-13-18-12-15(17(21)23-18)10-8-6-4-2-1-3-5-7-9-11-16(20)22-14-18/h10,19H,1-9,11-14H2.
What are the key properties of 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione?
1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione has a molecular weight of 324.42 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-3,18-dioxabicyclo[14.2.1]nonadec-15-ene-4,17-dione is sourced from PubChem (CID 15974483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).