C10H14Cl2N2O2 — CID 159745049
1,1-dichloro-4-ethoxybut-3-en-2-one;1-methylpyrazole (PubChem CID 159745049) has the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 1,1-dichloro-4-ethoxybut-3-en-2-one;1-methylpyrazole.
| Compound Name | 1,1-dichloro-4-ethoxybut-3-en-2-one;1-methylpyrazole |
|---|---|
| PubChem CID | 159745049 |
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1,1-dichloro-4-ethoxybut-3-en-2-one;1-methylpyrazole |
| SMILES | CCOC=CC(=O)C(Cl)Cl.Cn1cccn1 |
| InChI | InChI=1S/C6H8Cl2O2.C4H6N2/c1-2-10-4-3-5(9)6(7)8;1-6-4-2-3-5-6/h3-4,6H,2H2,1H3;2-4H,1H3 |
| InChIKey | NCYBJJWKBHNGKN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|