About (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone
(2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone (PubChem CID 159745251) has the molecular formula C21H21N3O2S
and a molecular weight of 379.49 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone |
| PubChem CID | 159745251 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1csc(-c2ccccc2)n1)N1CCCCC1COc1cccnc1 |
| InChI | InChI=1S/C21H21N3O2S/c25-21(19-15-27-20(23-19)16-7-2-1-3-8-16)24-12-5-4-9-17(24)14-26-18-10-6-11-22-13-18/h1-3,6-8,10-11,13,15,17H,4-5,9,12,14H2 |
| InChIKey | UECYCWOKRRXQIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone (CID 159745251) is (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone is O=C(c1csc(-c2ccccc2)n1)N1CCCCC1COc1cccnc1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone?
The InChIKey is UECYCWOKRRXQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2S/c25-21(19-15-27-20(23-19)16-7-2-1-3-8-16)24-12-5-4-9-17(24)14-26-18-10-6-11-22-13-18/h1-3,6-8,10-11,13,15,17H,4-5,9,12,14H2.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone?
(2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone has a molecular weight of 379.49 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)-[2-(pyridin-3-yloxymethyl)piperidin-1-yl]methanone is sourced from PubChem (CID 159745251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).