C26H26N12O4 — CID 159745816
4-diazenyl-1H-imidazole-5-carboxamide;2-isocyanatoethylbenzene;4-oxo-3-(2-phenylethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 159745816) has the molecular formula C26H26N12O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is 4-diazenyl-1H-imidazole-5-carboxamide;2-isocyanatoethylbenzene;4-oxo-3-(2-phenylethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | 4-diazenyl-1H-imidazole-5-carboxamide;2-isocyanatoethylbenzene;4-oxo-3-(2-phenylethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 159745816 |
| Molecular Formula | C26H26N12O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 4-diazenyl-1H-imidazole-5-carboxamide;2-isocyanatoethylbenzene;4-oxo-3-(2-phenylethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | NC(=O)c1ncn2c(=O)n(CCc3ccccc3)nnc12.O=C=NCCc1ccccc1.[H]/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C13H12N6O2.C9H9NO.C4H5N5O/c14-11(20)10-12-16-17-19(13(21)18(12)8-15-10)7-6-9-4-2-1-3-5-9;11-8-10-7-6-9-4-2-1-3-5-9;5-3(10)2-4(9-6)8-1-7-2/h1-5,8H,6-7H2,(H2,14,20);1-5H,6-7H2;1,6H,(H2,5,10)(H,7,8)/b;;9-6+ |
| InChIKey | KFSJZSRGUWFQPC-TZXPNQOBSA-N |
| XLogP | 1.36 |
| TPSA | 245.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|