C12H20I2Ru — CID 159746066
1,2,3,4,5,6-hexamethylbenzene;ruthenium;dihydroiodide (PubChem CID 159746066) has the molecular formula C12H20I2Ru and a molecular weight of 519.17 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylbenzene;ruthenium;dihydroiodide.
| Compound Name | 1,2,3,4,5,6-hexamethylbenzene;ruthenium;dihydroiodide |
|---|---|
| PubChem CID | 159746066 |
| Molecular Formula | C12H20I2Ru |
| Molecular Weight | 519.17 g/mol |
| Exact Mass | 519.87 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylbenzene;ruthenium;dihydroiodide |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.I.I.[Ru] |
| InChI | InChI=1S/C12H18.2HI.Ru/c1-7-8(2)10(4)12(6)11(5)9(7)3;;;/h1-6H3;2*1H; |
| InChIKey | LZGJNRKIVUEYPB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.17 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|