About 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane
2-chlorobutane;4-chloro-2-methylperoxyhexane;methane (PubChem CID 159746439) has the molecular formula C13H32Cl2O2
and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane.
Molecular Properties
| Compound Name | 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane |
| PubChem CID | 159746439 |
| Molecular Formula | C13H32Cl2O2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane |
| SMILES | C.C.CCC(C)Cl.CCC(Cl)CC(C)OOC |
| InChI | InChI=1S/C7H15ClO2.C4H9Cl.2CH4/c1-4-7(8)5-6(2)10-9-3;1-3-4(2)5;;/h6-7H,4-5H2,1-3H3;4H,3H2,1-2H3;2*1H4 |
| InChIKey | NDCBYUNYZAFCSJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane?
The IUPAC name of 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane (CID 159746439) is 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane.
What is the SMILES notation for 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane?
The canonical SMILES for 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane is C.C.CCC(C)Cl.CCC(Cl)CC(C)OOC.
What is the InChIKey of 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane?
The InChIKey is NDCBYUNYZAFCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClO2.C4H9Cl.2CH4/c1-4-7(8)5-6(2)10-9-3;1-3-4(2)5;;/h6-7H,4-5H2,1-3H3;4H,3H2,1-2H3;2*1H4.
What are the key properties of 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane?
2-chlorobutane;4-chloro-2-methylperoxyhexane;methane has a molecular weight of 291.30 g/mol, XLogP of 5.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutane;4-chloro-2-methylperoxyhexane;methane is sourced from PubChem (CID 159746439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).