About 2H-3,1-benzoselenazine
2H-3,1-benzoselenazine (PubChem CID 159746479) has the molecular formula C8H7NSe
and a molecular weight of 196.11 g/mol. Its IUPAC name is 2H-3,1-benzoselenazine.
Molecular Properties
| Compound Name | 2H-3,1-benzoselenazine |
| PubChem CID | 159746479 |
| Molecular Formula | C8H7NSe |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 2H-3,1-benzoselenazine |
| SMILES | C1=c2ccccc2=NC[Se]1 |
| InChI | InChI=1S/C8H7NSe/c1-2-4-8-7(3-1)5-10-6-9-8/h1-5H,6H2 |
| InChIKey | NDCGFNMXXGZREB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-3,1-benzoselenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-3,1-benzoselenazine?
The IUPAC name of 2H-3,1-benzoselenazine (CID 159746479) is 2H-3,1-benzoselenazine.
What is the SMILES notation for 2H-3,1-benzoselenazine?
The canonical SMILES for 2H-3,1-benzoselenazine is C1=c2ccccc2=NC[Se]1.
What is the InChIKey of 2H-3,1-benzoselenazine?
The InChIKey is NDCGFNMXXGZREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NSe/c1-2-4-8-7(3-1)5-10-6-9-8/h1-5H,6H2.
What are the key properties of 2H-3,1-benzoselenazine?
2H-3,1-benzoselenazine has a molecular weight of 196.11 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-3,1-benzoselenazine is sourced from PubChem (CID 159746479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).