C31H54O5Si2 — CID 15974669
(3E,6S,7S,8Z,10E,13S,15R)-6-methyl-7,13-bis(triethylsilyloxy)-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione (PubChem CID 15974669) has the molecular formula C31H54O5Si2 and a molecular weight of 562.94 g/mol. Its IUPAC name is (3E,6S,7S,8Z,10E,13S,15R)-6-methyl-7,13-bis(triethylsilyloxy)-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione.
| Compound Name | (3E,6S,7S,8Z,10E,13S,15R)-6-methyl-7,13-bis(triethylsilyloxy)-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione |
|---|---|
| PubChem CID | 15974669 |
| Molecular Formula | C31H54O5Si2 |
| Molecular Weight | 562.94 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (3E,6S,7S,8Z,10E,13S,15R)-6-methyl-7,13-bis(triethylsilyloxy)-16-oxabicyclo[13.2.2]nonadeca-3,8,10-triene-17,18-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1C/C=C/C=C\[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C/C=C/CC2C(=O)C[C@@H](C1)OC2=O |
| InChI | InChI=1S/C31H54O5Si2/c1-8-37(9-2,10-3)35-26-20-15-14-16-22-30(36-38(11-4,12-5)13-6)25(7)19-17-18-21-28-29(32)24-27(23-26)34-31(28)33/h14-18,22,25-28,30H,8-13,19-21,23-24H2,1-7H3/b15-14+,18-17+,22-16-/t25-,26-,27+,28?,30+/m0/s1 |
| InChIKey | WQPYOQYSMVIKNX-ZINBXCLKSA-N |
| XLogP | 8.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.94 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|