C30H28O6 — CID 159747693
bis(4-hydroxy-3,5-dimethylphenyl)methanone;bis(4-hydroxyphenyl)methanone (PubChem CID 159747693) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is bis(4-hydroxy-3,5-dimethylphenyl)methanone;bis(4-hydroxyphenyl)methanone.
| Compound Name | bis(4-hydroxy-3,5-dimethylphenyl)methanone;bis(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 159747693 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | bis(4-hydroxy-3,5-dimethylphenyl)methanone;bis(4-hydroxyphenyl)methanone |
| SMILES | Cc1cc(C(=O)c2cc(C)c(O)c(C)c2)cc(C)c1O.O=C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18O3.C13H10O3/c1-9-5-13(6-10(2)15(9)18)17(20)14-7-11(3)16(19)12(4)8-14;14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h5-8,18-19H,1-4H3;1-8,14-15H |
| InChIKey | NDGFKJXYIIQOCI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |