C28H26ClNO3 — CID 159747968
7-chloro-12,12-dimethyl-18-phenyl-17-oxa-19-azahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione (PubChem CID 159747968) has the molecular formula C28H26ClNO3 and a molecular weight of 459.97 g/mol. Its IUPAC name is 7-chloro-12,12-dimethyl-18-phenyl-17-oxa-19-azahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione.
| Compound Name | 7-chloro-12,12-dimethyl-18-phenyl-17-oxa-19-azahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione |
|---|---|
| PubChem CID | 159747968 |
| Molecular Formula | C28H26ClNO3 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 7-chloro-12,12-dimethyl-18-phenyl-17-oxa-19-azahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione |
| SMILES | CC1(C)C2=C(CC34CC(=O)C5(COC(c6ccccc6)N5C3=O)CC14)c1ccc(Cl)cc1C2 |
| InChI | InChI=1S/C28H26ClNO3/c1-26(2)21-11-17-10-18(29)8-9-19(17)20(21)12-27-14-23(31)28(13-22(26)27)15-33-24(30(28)25(27)32)16-6-4-3-5-7-16/h3-10,22,24H,11-15H2,1-2H3 |
| InChIKey | UGBWBLGUPIZQMM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |