C30H35ClO5 — CID 15974829
(2R,2'S,4R,9'E,11'S)-9'-chloro-2'-ethyl-11'-methyl-2-(2,4,6-trimethylphenyl)spiro[1,3-dioxolane-4,7'-3-oxabicyclo[11.3.1]heptadeca-1(16),9,13(17),14-tetraene]-4',6'-dione (PubChem CID 15974829) has the molecular formula C30H35ClO5 and a molecular weight of 511.06 g/mol. Its IUPAC name is (2R,2'S,4R,9'E,11'S)-9'-chloro-2'-ethyl-11'-methyl-2-(2,4,6-trimethylphenyl)spiro[1,3-dioxolane-4,7'-3-oxabicyclo[11.3.1]heptadeca-1(16),9,13(17),14-tetraene]-4',6'-dione.
| Compound Name | (2R,2'S,4R,9'E,11'S)-9'-chloro-2'-ethyl-11'-methyl-2-(2,4,6-trimethylphenyl)spiro[1,3-dioxolane-4,7'-3-oxabicyclo[11.3.1]heptadeca-1(16),9,13(17),14-tetraene]-4',6'-dione |
|---|---|
| PubChem CID | 15974829 |
| Molecular Formula | C30H35ClO5 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (2R,2'S,4R,9'E,11'S)-9'-chloro-2'-ethyl-11'-methyl-2-(2,4,6-trimethylphenyl)spiro[1,3-dioxolane-4,7'-3-oxabicyclo[11.3.1]heptadeca-1(16),9,13(17),14-tetraene]-4',6'-dione |
| SMILES | CC[C@@H]1OC(=O)CC(=O)[C@]2(CO[C@@H](c3c(C)cc(C)cc3C)O2)C/C(Cl)=C\[C@@H](C)Cc2cccc1c2 |
| InChI | InChI=1S/C30H35ClO5/c1-6-25-23-9-7-8-22(14-23)12-19(3)13-24(31)16-30(26(32)15-27(33)35-25)17-34-29(36-30)28-20(4)10-18(2)11-21(28)5/h7-11,13-14,19,25,29H,6,12,15-17H2,1-5H3/b24-13+/t19-,25-,29+,30+/m0/s1 |
| InChIKey | UYVHVLVWZBIYAN-WJPSCVQQSA-N |
| XLogP | 6.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|