C19H25N4NaO9S — CID 159748786
sodium;2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;1,1-dioxo-1,2-benzothiazol-2-id-3-one (PubChem CID 159748786) has the molecular formula C19H25N4NaO9S and a molecular weight of 508.49 g/mol. Its IUPAC name is sodium;2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;1,1-dioxo-1,2-benzothiazol-2-id-3-one.
| Compound Name | sodium;2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;1,1-dioxo-1,2-benzothiazol-2-id-3-one |
|---|---|
| PubChem CID | 159748786 |
| Molecular Formula | C19H25N4NaO9S |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | sodium;2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid;1,1-dioxo-1,2-benzothiazol-2-id-3-one |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.O=C1[N-]S(=O)(=O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C12H21N3O6.C7H5NO3S.Na/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21;9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h1-9H2,(H,16,17)(H,18,19)(H,20,21);1-4H,(H,8,9);/q;;+1/p-1 |
| InChIKey | HHUNMJBOQXSDPZ-UHFFFAOYSA-M |
| XLogP | -3.93 |
| TPSA | 186.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |