C10H13Cl5N2O — CID 159749309
chloroform;(2,4-dichloro-5-propan-2-yloxyphenyl)hydrazine (PubChem CID 159749309) has the molecular formula C10H13Cl5N2O and a molecular weight of 354.49 g/mol. Its IUPAC name is chloroform;(2,4-dichloro-5-propan-2-yloxyphenyl)hydrazine.
| Compound Name | chloroform;(2,4-dichloro-5-propan-2-yloxyphenyl)hydrazine |
|---|---|
| PubChem CID | 159749309 |
| Molecular Formula | C10H13Cl5N2O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | chloroform;(2,4-dichloro-5-propan-2-yloxyphenyl)hydrazine |
| SMILES | CC(C)Oc1cc(NN)c(Cl)cc1Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C9H12Cl2N2O.CHCl3/c1-5(2)14-9-4-8(13-12)6(10)3-7(9)11;2-1(3)4/h3-5,13H,12H2,1-2H3;1H |
| InChIKey | NDLJGBNPQPHMBK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|