C12H12F12O2 — CID 159749836
2-(fluoromethyl)oxirane;2-(2,3,3,4,4,5,5,6,6,7,7-undecafluoroheptyl)oxirane (PubChem CID 159749836) has the molecular formula C12H12F12O2 and a molecular weight of 416.20 g/mol. Its IUPAC name is 2-(fluoromethyl)oxirane;2-(2,3,3,4,4,5,5,6,6,7,7-undecafluoroheptyl)oxirane.
| Compound Name | 2-(fluoromethyl)oxirane;2-(2,3,3,4,4,5,5,6,6,7,7-undecafluoroheptyl)oxirane |
|---|---|
| PubChem CID | 159749836 |
| Molecular Formula | C12H12F12O2 |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-(fluoromethyl)oxirane;2-(2,3,3,4,4,5,5,6,6,7,7-undecafluoroheptyl)oxirane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC1CO1.FCC1CO1 |
| InChI | InChI=1S/C9H7F11O.C3H5FO/c10-4(1-3-2-21-3)6(13,14)8(17,18)9(19,20)7(15,16)5(11)12;4-1-3-2-5-3/h3-5H,1-2H2;3H,1-2H2 |
| InChIKey | NDMZTEBPNLSRLV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|