C16H29BrF2O3 — CID 159751594
(3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane;(3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-ol (PubChem CID 159751594) has the molecular formula C16H29BrF2O3 and a molecular weight of 387.31 g/mol. Its IUPAC name is (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane;(3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-ol.
| Compound Name | (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane;(3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 159751594 |
| Molecular Formula | C16H29BrF2O3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3R,4R,5R)-2-bromo-5-ethyl-3-fluoro-3,4-dimethyloxolane;(3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-ol |
| SMILES | CC[C@H]1OC(Br)[C@](C)(F)[C@@H]1C.CC[C@H]1OC(O)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C8H14BrFO.C8H15FO2/c1-4-6-5(2)8(3,10)7(9)11-6;1-4-6-5(2)8(3,9)7(10)11-6/h5-7H,4H2,1-3H3;5-7,10H,4H2,1-3H3/t2*5-,6-,7?,8-/m11/s1 |
| InChIKey | NDSIODYIGLBDRU-IUPPQVELSA-N |
| XLogP | 4.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|