About diethoxy(oxo)phosphanium;1-methylpiperidine
diethoxy(oxo)phosphanium;1-methylpiperidine (PubChem CID 159752733) has the molecular formula C10H23NO3P+
and a molecular weight of 236.27 g/mol. Its IUPAC name is diethoxy(oxo)phosphanium;1-methylpiperidine.
Molecular Properties
| Compound Name | diethoxy(oxo)phosphanium;1-methylpiperidine |
| PubChem CID | 159752733 |
| Molecular Formula | C10H23NO3P+ |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | diethoxy(oxo)phosphanium;1-methylpiperidine |
| SMILES | CCO[P+](=O)OCC.CN1CCCCC1 |
| InChI | InChI=1S/C6H13N.C4H10O3P/c1-7-5-3-2-4-6-7;1-3-6-8(5)7-4-2/h2-6H2,1H3;3-4H2,1-2H3/q;+1 |
| InChIKey | LROQSPUCLKPMOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(oxo)phosphanium;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(oxo)phosphanium;1-methylpiperidine?
The IUPAC name of diethoxy(oxo)phosphanium;1-methylpiperidine (CID 159752733) is diethoxy(oxo)phosphanium;1-methylpiperidine.
What is the SMILES notation for diethoxy(oxo)phosphanium;1-methylpiperidine?
The canonical SMILES for diethoxy(oxo)phosphanium;1-methylpiperidine is CCO[P+](=O)OCC.CN1CCCCC1.
What is the InChIKey of diethoxy(oxo)phosphanium;1-methylpiperidine?
The InChIKey is LROQSPUCLKPMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C4H10O3P/c1-7-5-3-2-4-6-7;1-3-6-8(5)7-4-2/h2-6H2,1H3;3-4H2,1-2H3/q;+1.
What are the key properties of diethoxy(oxo)phosphanium;1-methylpiperidine?
diethoxy(oxo)phosphanium;1-methylpiperidine has a molecular weight of 236.27 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(oxo)phosphanium;1-methylpiperidine is sourced from PubChem (CID 159752733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).