About 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline
2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline (PubChem CID 159755082) has the molecular formula C17H15BrClN3O4
and a molecular weight of 440.68 g/mol. Its IUPAC name is 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline.
Molecular Properties
| Compound Name | 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline |
| PubChem CID | 159755082 |
| Molecular Formula | C17H15BrClN3O4 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline |
| SMILES | COc1cc(Br)cc2cnc(Cl)nc12.COc1cccc(C(=O)O)c1N |
| InChI | InChI=1S/C9H6BrClN2O.C8H9NO3/c1-14-7-3-6(10)2-5-4-12-9(11)13-8(5)7;1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3;2-4H,9H2,1H3,(H,10,11) |
| InChIKey | NEDRNVHMRDVPBP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline?
The IUPAC name of 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline (CID 159755082) is 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline.
What is the SMILES notation for 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline?
The canonical SMILES for 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline is COc1cc(Br)cc2cnc(Cl)nc12.COc1cccc(C(=O)O)c1N.
What is the InChIKey of 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline?
The InChIKey is NEDRNVHMRDVPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClN2O.C8H9NO3/c1-14-7-3-6(10)2-5-4-12-9(11)13-8(5)7;1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3;2-4H,9H2,1H3,(H,10,11).
What are the key properties of 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline?
2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline has a molecular weight of 440.68 g/mol, XLogP of 4.03, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methoxybenzoic acid;6-bromo-2-chloro-8-methoxyquinazoline is sourced from PubChem (CID 159755082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).