About (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde
(3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde (PubChem CID 159755252) has the molecular formula C21H23F3O6S
and a molecular weight of 460.47 g/mol. Its IUPAC name is (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde.
Molecular Properties
| Compound Name | (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde |
| PubChem CID | 159755252 |
| Molecular Formula | C21H23F3O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde |
| SMILES | CCc1cc(C)cc(O)c1C=O.CCc1cc(C)cc(OS(=O)(=O)C(F)(F)F)c1C=O |
| InChI | InChI=1S/C11H11F3O4S.C10H12O2/c1-3-8-4-7(2)5-10(9(8)6-15)18-19(16,17)11(12,13)14;1-3-8-4-7(2)5-10(12)9(8)6-11/h4-6H,3H2,1-2H3;4-6,12H,3H2,1-2H3 |
| InChIKey | NEEFJQAFBPUKKD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde?
The IUPAC name of (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde (CID 159755252) is (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde.
What is the SMILES notation for (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde?
The canonical SMILES for (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde is CCc1cc(C)cc(O)c1C=O.CCc1cc(C)cc(OS(=O)(=O)C(F)(F)F)c1C=O.
What is the InChIKey of (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde?
The InChIKey is NEEFJQAFBPUKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O4S.C10H12O2/c1-3-8-4-7(2)5-10(9(8)6-15)18-19(16,17)11(12,13)14;1-3-8-4-7(2)5-10(12)9(8)6-11/h4-6H,3H2,1-2H3;4-6,12H,3H2,1-2H3.
What are the key properties of (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde?
(3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde has a molecular weight of 460.47 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-2-formyl-5-methylphenyl) trifluoromethanesulfonate;2-ethyl-6-hydroxy-4-methylbenzaldehyde is sourced from PubChem (CID 159755252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).