C24H33FO2Si — CID 159756160
2-trimethylsilylethyl 2-[4-(4-fluorophenyl)-4-tetracyclo[5.3.1.03,9.05,9]undecanyl]acetate (PubChem CID 159756160) has the molecular formula C24H33FO2Si and a molecular weight of 400.61 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[4-(4-fluorophenyl)-4-tetracyclo[5.3.1.03,9.05,9]undecanyl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[4-(4-fluorophenyl)-4-tetracyclo[5.3.1.03,9.05,9]undecanyl]acetate |
|---|---|
| PubChem CID | 159756160 |
| Molecular Formula | C24H33FO2Si |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-trimethylsilylethyl 2-[4-(4-fluorophenyl)-4-tetracyclo[5.3.1.03,9.05,9]undecanyl]acetate |
| SMILES | C[Si](C)(C)CCOC(=O)CC1(c2ccc(F)cc2)C2CC3CC4CC1C2(C3)C4 |
| InChI | InChI=1S/C24H33FO2Si/c1-28(2,3)9-8-27-22(26)15-24(18-4-6-19(25)7-5-18)20-11-16-10-17-12-21(24)23(20,13-16)14-17/h4-7,16-17,20-21H,8-15H2,1-3H3 |
| InChIKey | NEHGODRISSWIKF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|