About 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane
2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane (PubChem CID 159756975) has the molecular formula C20H20BrClSi
and a molecular weight of 403.82 g/mol. Its IUPAC name is 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane.
Molecular Properties
| Compound Name | 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane |
| PubChem CID | 159756975 |
| Molecular Formula | C20H20BrClSi |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane |
| SMILES | BrC1=Cc2ccccc2C1.C[Si](C)(Cl)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13ClSi.C9H7Br/c1-13(2,12)11-7-9-5-3-4-6-10(9)8-11;10-9-5-7-3-1-2-4-8(7)6-9/h3-7H,8H2,1-2H3;1-5H,6H2 |
| InChIKey | NEJVHZLZTSESSC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane?
The IUPAC name of 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane (CID 159756975) is 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane.
What is the SMILES notation for 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane?
The canonical SMILES for 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane is BrC1=Cc2ccccc2C1.C[Si](C)(Cl)C1=Cc2ccccc2C1.
What is the InChIKey of 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane?
The InChIKey is NEJVHZLZTSESSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClSi.C9H7Br/c1-13(2,12)11-7-9-5-3-4-6-10(9)8-11;10-9-5-7-3-1-2-4-8(7)6-9/h3-7H,8H2,1-2H3;1-5H,6H2.
What are the key properties of 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane?
2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane has a molecular weight of 403.82 g/mol, XLogP of 6.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1H-indene;chloro-(1H-inden-2-yl)-dimethylsilane is sourced from PubChem (CID 159756975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).