C28H15Cl5F6N4 — CID 159758564
bis(6-chloro-5-(3-chloro-4-pyridinyl)-2-(trifluoromethyl)-1H-indole);hydrochloride (PubChem CID 159758564) has the molecular formula C28H15Cl5F6N4 and a molecular weight of 698.71 g/mol. Its IUPAC name is bis(6-chloro-5-(3-chloro-4-pyridinyl)-2-(trifluoromethyl)-1H-indole);hydrochloride.
| Compound Name | bis(6-chloro-5-(3-chloro-4-pyridinyl)-2-(trifluoromethyl)-1H-indole);hydrochloride |
|---|---|
| PubChem CID | 159758564 |
| Molecular Formula | C28H15Cl5F6N4 |
| Molecular Weight | 698.71 g/mol |
| Exact Mass | 695.96 |
| IUPAC Name | bis(6-chloro-5-(3-chloro-4-pyridinyl)-2-(trifluoromethyl)-1H-indole);hydrochloride |
| SMILES | Cl.FC(F)(F)c1cc2cc(-c3ccncc3Cl)c(Cl)cc2[nH]1.FC(F)(F)c1cc2cc(-c3ccncc3Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/2C14H7Cl2F3N2.ClH/c2*15-10-5-12-7(4-13(21-12)14(17,18)19)3-9(10)8-1-2-20-6-11(8)16;/h2*1-6,21H;1H |
| InChIKey | WQOHSBQLYGOIRG-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.71 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |