C24H44N4O4 — CID 159759290
2-methyl-N-[1-(2-methylpropanoyl)pyrrolidin-3-yl]propanamide (PubChem CID 159759290) has the molecular formula C24H44N4O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-methyl-N-[1-(2-methylpropanoyl)pyrrolidin-3-yl]propanamide.
| Compound Name | 2-methyl-N-[1-(2-methylpropanoyl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 159759290 |
| Molecular Formula | C24H44N4O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 2-methyl-N-[1-(2-methylpropanoyl)pyrrolidin-3-yl]propanamide |
| SMILES | CC(C)C(=O)NC1CCN(C(=O)C(C)C)C1.CC(C)C(=O)NC1CCN(C(=O)C(C)C)C1 |
| InChI | InChI=1S/2C12H22N2O2/c2*1-8(2)11(15)13-10-5-6-14(7-10)12(16)9(3)4/h2*8-10H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | NERAZIMHMMLIQF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |