C30H43NO7Si — CID 15975946
(5S,8R,9R)-2-[(2S,3S)-3-[(Z)-but-1-enyl]oxiran-2-yl]-8-hydroxy-8-[hydroxy(phenyl)methyl]-3-methyl-9-tri(propan-2-yl)silyloxy-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 15975946) has the molecular formula C30H43NO7Si and a molecular weight of 557.76 g/mol. Its IUPAC name is (5S,8R,9R)-2-[(2S,3S)-3-[(Z)-but-1-enyl]oxiran-2-yl]-8-hydroxy-8-[hydroxy(phenyl)methyl]-3-methyl-9-tri(propan-2-yl)silyloxy-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8R,9R)-2-[(2S,3S)-3-[(Z)-but-1-enyl]oxiran-2-yl]-8-hydroxy-8-[hydroxy(phenyl)methyl]-3-methyl-9-tri(propan-2-yl)silyloxy-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 15975946 |
| Molecular Formula | C30H43NO7Si |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (5S,8R,9R)-2-[(2S,3S)-3-[(Z)-but-1-enyl]oxiran-2-yl]-8-hydroxy-8-[hydroxy(phenyl)methyl]-3-methyl-9-tri(propan-2-yl)silyloxy-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C\[C@@H]1O[C@@H]1C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](O)(C(O)c1ccccc1)[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H43NO7Si/c1-9-10-16-22-24(36-22)23-20(8)25(32)29(37-23)27(38-39(17(2)3,18(4)5)19(6)7)30(35,31-28(29)34)26(33)21-14-12-11-13-15-21/h10-19,22,24,26-27,33,35H,9H2,1-8H3,(H,31,34)/b16-10-/t22-,24-,26?,27+,29+,30+/m0/s1 |
| InChIKey | BIJCPGORKXXGSC-ULHUTCJISA-N |
| XLogP | 4.44 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|