C28H44N4O2 — CID 159760014
2-[(3R,4aR,8aR)-7-(dimethylaminomethylidene)-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-N-benzyl-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 159760014) has the molecular formula C28H44N4O2 and a molecular weight of 468.69 g/mol. Its IUPAC name is 2-[(3R,4aR,8aR)-7-(dimethylaminomethylidene)-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-N-benzyl-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-[(3R,4aR,8aR)-7-(dimethylaminomethylidene)-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-N-benzyl-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 159760014 |
| Molecular Formula | C28H44N4O2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | 2-[(3R,4aR,8aR)-7-(dimethylaminomethylidene)-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-N-benzyl-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CCCN1C[C@@H](CC(=O)N(CCN(C)C)Cc2ccccc2)C[C@@H]2CC(=O)C(=CN(C)C)C[C@H]21 |
| InChI | InChI=1S/C28H44N4O2/c1-6-12-31-20-23(15-24-18-27(33)25(17-26(24)31)21-30(4)5)16-28(34)32(14-13-29(2)3)19-22-10-8-7-9-11-22/h7-11,21,23-24,26H,6,12-20H2,1-5H3/t23-,24-,26-/m1/s1 |
| InChIKey | NETHGLWJCYSDSD-DGWZTRNLSA-N |
| XLogP | 3.49 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|