About ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride
ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride (PubChem CID 159760528) has the molecular formula C24H21Cl4N2O6P
and a molecular weight of 606.23 g/mol. Its IUPAC name is ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride.
Molecular Properties
| Compound Name | ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride |
| PubChem CID | 159760528 |
| Molecular Formula | C24H21Cl4N2O6P |
| Molecular Weight | 606.23 g/mol |
| Exact Mass | 603.99 |
| IUPAC Name | ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride |
| SMILES | CCOC(=O)c1ccc2[nH]ccc(=O)c2c1.CCOC(=O)c1ccc2nccc(Cl)c2c1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H10ClNO2.C12H11NO3.Cl3OP/c1-2-16-12(15)8-3-4-11-9(7-8)10(13)5-6-14-11;1-2-16-12(15)8-3-4-10-9(7-8)11(14)5-6-13-10;1-5(2,3)4/h3-7H,2H2,1H3;3-7H,2H2,1H3,(H,13,14); |
| InChIKey | NEUZEAVDAYNYGD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.23 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride?
The IUPAC name of ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride (CID 159760528) is ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride.
What is the SMILES notation for ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride?
The canonical SMILES for ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride is CCOC(=O)c1ccc2[nH]ccc(=O)c2c1.CCOC(=O)c1ccc2nccc(Cl)c2c1.O=P(Cl)(Cl)Cl.
What is the InChIKey of ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride?
The InChIKey is NEUZEAVDAYNYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO2.C12H11NO3.Cl3OP/c1-2-16-12(15)8-3-4-11-9(7-8)10(13)5-6-14-11;1-2-16-12(15)8-3-4-10-9(7-8)11(14)5-6-13-10;1-5(2,3)4/h3-7H,2H2,1H3;3-7H,2H2,1H3,(H,13,14);.
What are the key properties of ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride?
ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride has a molecular weight of 606.23 g/mol, XLogP of 7.58, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloroquinoline-6-carboxylate;ethyl 4-oxo-1H-quinoline-6-carboxylate;phosphoryl trichloride is sourced from PubChem (CID 159760528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).