C19H21NO4S — CID 15976098
(1R,2R,5R,6R,8R,9S)-9-methyl-8-[[(R)-(4-methylphenyl)sulfinyl]methyl]-3-oxa-7-azatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione (PubChem CID 15976098) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (1R,2R,5R,6R,8R,9S)-9-methyl-8-[[(R)-(4-methylphenyl)sulfinyl]methyl]-3-oxa-7-azatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione.
| Compound Name | (1R,2R,5R,6R,8R,9S)-9-methyl-8-[[(R)-(4-methylphenyl)sulfinyl]methyl]-3-oxa-7-azatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
|---|---|
| PubChem CID | 15976098 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (1R,2R,5R,6R,8R,9S)-9-methyl-8-[[(R)-(4-methylphenyl)sulfinyl]methyl]-3-oxa-7-azatetracyclo[6.4.0.02,6.05,9]dodecane-4,11-dione |
| SMILES | Cc1ccc([S@](=O)C[C@]23N[C@H]4[C@@H]5OC(=O)[C@@H]4[C@]2(C)CC(=O)C[C@@H]53)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-10-3-5-12(6-4-10)25(23)9-19-13-7-11(21)8-18(19,2)14-15(20-19)16(13)24-17(14)22/h3-6,13-16,20H,7-9H2,1-2H3/t13-,14+,15+,16+,18-,19+,25+/m0/s1 |
| InChIKey | SUWJQGSGRRMHNB-NBFAPCGBSA-N |
| XLogP | 1.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |