C16H27BNO7P — CID 159761670
4-ethyl-2-[(2R)-5-[(2-methyl-3-phosphanylpropanoyl)amino]-4-oxohexan-2-yl]-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid (PubChem CID 159761670) has the molecular formula C16H27BNO7P and a molecular weight of 387.18 g/mol. Its IUPAC name is 4-ethyl-2-[(2R)-5-[(2-methyl-3-phosphanylpropanoyl)amino]-4-oxohexan-2-yl]-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid.
| Compound Name | 4-ethyl-2-[(2R)-5-[(2-methyl-3-phosphanylpropanoyl)amino]-4-oxohexan-2-yl]-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid |
|---|---|
| PubChem CID | 159761670 |
| Molecular Formula | C16H27BNO7P |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-ethyl-2-[(2R)-5-[(2-methyl-3-phosphanylpropanoyl)amino]-4-oxohexan-2-yl]-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid |
| SMILES | CCC1(C(=O)O)CC(=O)OB([C@H](C)CC(=O)C(C)NC(=O)C(C)CP)O1 |
| InChI | InChI=1S/C16H27BNO7P/c1-5-16(15(22)23)7-13(20)24-17(25-16)10(3)6-12(19)11(4)18-14(21)9(2)8-26/h9-11H,5-8,26H2,1-4H3,(H,18,21)(H,22,23)/t9?,10-,11?,16?/m1/s1 |
| InChIKey | ZHNLQJFVEXOVIK-DQZPJKIRSA-N |
| XLogP | 1.04 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|