C38H46O6SSi — CID 15976197
(1S,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecane-3-carbaldehyde (PubChem CID 15976197) has the molecular formula C38H46O6SSi and a molecular weight of 658.93 g/mol. Its IUPAC name is (1S,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecane-3-carbaldehyde.
| Compound Name | (1S,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecane-3-carbaldehyde |
|---|---|
| PubChem CID | 15976197 |
| Molecular Formula | C38H46O6SSi |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | (1S,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecane-3-carbaldehyde |
| SMILES | CC1(C)[C@@H]2C[C@@]3(CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(=O)CC[C@]1(C=O)[C@H]3O[C@H]2CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H46O6SSi/c1-35(2,3)46(29-17-11-7-12-18-29,30-19-13-8-14-20-30)43-24-23-37-25-31-32(26-45(41,42)28-15-9-6-10-16-28)44-34(37)38(27-39,36(31,4)5)22-21-33(37)40/h6-20,27,31-32,34H,21-26H2,1-5H3/t31-,32+,34+,37+,38+/m1/s1 |
| InChIKey | VCFYTZIRNLJVIH-PDDPKBQHSA-N |
| XLogP | 5.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|