About 1H-indene;quinazoline
1H-indene;quinazoline (PubChem CID 159761989) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1H-indene;quinazoline.
Molecular Properties
| Compound Name | 1H-indene;quinazoline |
| PubChem CID | 159761989 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1H-indene;quinazoline |
| SMILES | C1=Cc2ccccc2C1.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C9H8.C8H6N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-8-7(3-1)5-9-6-10-8/h1-6H,7H2;1-6H |
| InChIKey | NEZWPQVLMLAKHO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indene;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;quinazoline?
The IUPAC name of 1H-indene;quinazoline (CID 159761989) is 1H-indene;quinazoline.
What is the SMILES notation for 1H-indene;quinazoline?
The canonical SMILES for 1H-indene;quinazoline is C1=Cc2ccccc2C1.c1ccc2ncncc2c1.
What is the InChIKey of 1H-indene;quinazoline?
The InChIKey is NEZWPQVLMLAKHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C8H6N2/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-8-7(3-1)5-9-6-10-8/h1-6H,7H2;1-6H.
What are the key properties of 1H-indene;quinazoline?
1H-indene;quinazoline has a molecular weight of 246.31 g/mol, XLogP of 3.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;quinazoline is sourced from PubChem (CID 159761989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).