C16H14F3N2O8P — CID 159762771
1-[(2R,3R,5R)-2-deuterio-5-fluoro-5-[(6-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-3-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 159762771) has the molecular formula C16H14F3N2O8P and a molecular weight of 451.27 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-2-deuterio-5-fluoro-5-[(6-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-3-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-2-deuterio-5-fluoro-5-[(6-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-3-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159762771 |
| Molecular Formula | C16H14F3N2O8P |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 1-[(2R,3R,5R)-2-deuterio-5-fluoro-5-[(6-fluoro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-3-hydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | [2H][C@@]1(n2cc(F)c(=O)[nH]c2=O)O[C@](F)(COP2(=O)OCc3cc(F)ccc3O2)C[C@H]1O |
| InChI | InChI=1S/C16H14F3N2O8P/c17-9-1-2-12-8(3-9)6-26-30(25,29-12)27-7-16(19)4-11(22)14(28-16)21-5-10(18)13(23)20-15(21)24/h1-3,5,11,14,22H,4,6-7H2,(H,20,23,24)/t11-,14-,16+,30?/m1/s1/i14D |
| InChIKey | MGZOTKQMPKINHI-HPCCRTOOSA-N |
| XLogP | 1.49 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|